C13H17Cl2N3O3 — CID 106891941
1-(2,6-dichloro-4-nitrophenyl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol (PubChem CID 106891941) has the molecular formula C13H17Cl2N3O3 and a molecular weight of 334.20 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
| Compound Name | 1-(2,6-dichloro-4-nitrophenyl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 106891941 |
| Molecular Formula | C13H17Cl2N3O3 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenyl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| SMILES | CN(C)CC1CC(O)CN1c1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C13H17Cl2N3O3/c1-16(2)6-9-3-10(19)7-17(9)13-11(14)4-8(18(20)21)5-12(13)15/h4-5,9-10,19H,3,6-7H2,1-2H3 |
| InChIKey | BLYIDHQGVLDHTI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|