C9H15FN6 — CID 80927536
[5-fluoro-4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]hydrazine (PubChem CID 80927536) has the molecular formula C9H15FN6 and a molecular weight of 226.26 g/mol. Its IUPAC name is [5-fluoro-4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-fluoro-4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80927536 |
| Molecular Formula | C9H15FN6 |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [5-fluoro-4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]hydrazine |
| SMILES | CN1CCN(c2nc(NN)ncc2F)CC1 |
| InChI | InChI=1S/C9H15FN6/c1-15-2-4-16(5-3-15)8-7(10)6-12-9(13-8)14-11/h6H,2-5,11H2,1H3,(H,12,13,14) |
| InChIKey | GQMSFMPGODFWJY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|