C10H17N7O2 — CID 114045124
[4-(4-methyl-1,4-diazepan-1-yl)-5-nitropyrimidin-2-yl]hydrazine (PubChem CID 114045124) has the molecular formula C10H17N7O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is [4-(4-methyl-1,4-diazepan-1-yl)-5-nitropyrimidin-2-yl]hydrazine.
| Compound Name | [4-(4-methyl-1,4-diazepan-1-yl)-5-nitropyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114045124 |
| Molecular Formula | C10H17N7O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | [4-(4-methyl-1,4-diazepan-1-yl)-5-nitropyrimidin-2-yl]hydrazine |
| SMILES | CN1CCCN(c2nc(NN)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C10H17N7O2/c1-15-3-2-4-16(6-5-15)9-8(17(18)19)7-12-10(13-9)14-11/h7H,2-6,11H2,1H3,(H,12,13,14) |
| InChIKey | GQIAANOMRIHTNN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|