C11H14N4O4 — CID 80502820
6-(4-methylpiperazin-1-yl)-5-nitropyridine-3-carboxylic acid (PubChem CID 80502820) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-(4-methylpiperazin-1-yl)-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 80502820 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-5-nitropyridine-3-carboxylic acid |
| SMILES | CN1CCN(c2ncc(C(=O)O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C11H14N4O4/c1-13-2-4-14(5-3-13)10-9(15(18)19)6-8(7-12-10)11(16)17/h6-7H,2-5H2,1H3,(H,16,17) |
| InChIKey | GSMDLOPLZNZTSI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|