C11H12N4O5 — CID 81438317
5-nitro-6-(5-oxo-1,4-diazepan-1-yl)pyridine-3-carboxylic acid (PubChem CID 81438317) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 5-nitro-6-(5-oxo-1,4-diazepan-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 5-nitro-6-(5-oxo-1,4-diazepan-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81438317 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 5-nitro-6-(5-oxo-1,4-diazepan-1-yl)pyridine-3-carboxylic acid |
| SMILES | O=C1CCN(c2ncc(C(=O)O)cc2[N+](=O)[O-])CCN1 |
| InChI | InChI=1S/C11H12N4O5/c16-9-1-3-14(4-2-12-9)10-8(15(19)20)5-7(6-13-10)11(17)18/h5-6H,1-4H2,(H,12,16)(H,17,18) |
| InChIKey | NBUBLNOBMVFOTF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|