C10H16FN5O — CID 80906159
[4-(2,2-dimethylmorpholin-4-yl)-5-fluoropyrimidin-2-yl]hydrazine (PubChem CID 80906159) has the molecular formula C10H16FN5O and a molecular weight of 241.27 g/mol. Its IUPAC name is [4-(2,2-dimethylmorpholin-4-yl)-5-fluoropyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,2-dimethylmorpholin-4-yl)-5-fluoropyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80906159 |
| Molecular Formula | C10H16FN5O |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | [4-(2,2-dimethylmorpholin-4-yl)-5-fluoropyrimidin-2-yl]hydrazine |
| SMILES | CC1(C)CN(c2nc(NN)ncc2F)CCO1 |
| InChI | InChI=1S/C10H16FN5O/c1-10(2)6-16(3-4-17-10)8-7(11)5-13-9(14-8)15-12/h5H,3-4,6,12H2,1-2H3,(H,13,14,15) |
| InChIKey | WGHGMHRCQHXHOB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|