C12H24N8O — CID 107226852
2-[4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanol (PubChem CID 107226852) has the molecular formula C12H24N8O and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-[4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 107226852 |
| Molecular Formula | C12H24N8O |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2-[4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanol |
| SMILES | CN(C)c1nc(NN)nc(N2CCCN(CCO)CC2)n1 |
| InChI | InChI=1S/C12H24N8O/c1-18(2)11-14-10(17-13)15-12(16-11)20-5-3-4-19(6-7-20)8-9-21/h21H,3-9,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | SHLOTUAFIAQKCX-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|