C9H17N7OS — CID 80905207
4-hydrazinyl-N,N-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)-1,3,5-triazin-2-amine (PubChem CID 80905207) has the molecular formula C9H17N7OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 4-hydrazinyl-N,N-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N,N-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80905207 |
| Molecular Formula | C9H17N7OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-hydrazinyl-N,N-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(NN)nc(N2CCS(=O)CC2)n1 |
| InChI | InChI=1S/C9H17N7OS/c1-15(2)8-11-7(14-10)12-9(13-8)16-3-5-18(17)6-4-16/h3-6,10H2,1-2H3,(H,11,12,13,14) |
| InChIKey | IKNWFUDTIRCOEY-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|