C12H22N8O — CID 80901624
1-[4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanone (PubChem CID 80901624) has the molecular formula C12H22N8O and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-[4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 80901624 |
| Molecular Formula | C12H22N8O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2nc(NN)nc(N(C)C)n2)CC1 |
| InChI | InChI=1S/C12H22N8O/c1-9(21)19-5-4-6-20(8-7-19)12-15-10(17-13)14-11(16-12)18(2)3/h4-8,13H2,1-3H3,(H,14,15,16,17) |
| InChIKey | CJTBXUGLHXXZHJ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|