C11H17FN4O — CID 143431082
2-[4-(5-fluoro-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol (PubChem CID 143431082) has the molecular formula C11H17FN4O and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-[4-(5-fluoro-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(5-fluoro-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 143431082 |
| Molecular Formula | C11H17FN4O |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[4-(5-fluoro-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol |
| SMILES | Cc1ncc(F)c(N2CCN(CCO)CC2)n1 |
| InChI | InChI=1S/C11H17FN4O/c1-9-13-8-10(12)11(14-9)16-4-2-15(3-5-16)6-7-17/h8,17H,2-7H2,1H3 |
| InChIKey | UCSRTBCHNWSGJV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |