C11H14F3N3O — CID 106547734
2-[4-(3,5,6-trifluoro-2-pyridinyl)piperazin-1-yl]ethanol (PubChem CID 106547734) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-[4-(3,5,6-trifluoro-2-pyridinyl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(3,5,6-trifluoro-2-pyridinyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 106547734 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[4-(3,5,6-trifluoro-2-pyridinyl)piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(c2nc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C11H14F3N3O/c12-8-7-9(13)11(15-10(8)14)17-3-1-16(2-4-17)5-6-18/h7,18H,1-6H2 |
| InChIKey | DXVVEMLUFZDQTF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|