C10H18N6O — CID 19137084
2-[4-(5,6-diaminopyrimidin-4-yl)piperazin-1-yl]ethanol (PubChem CID 19137084) has the molecular formula C10H18N6O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[4-(5,6-diaminopyrimidin-4-yl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(5,6-diaminopyrimidin-4-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 19137084 |
| Molecular Formula | C10H18N6O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-[4-(5,6-diaminopyrimidin-4-yl)piperazin-1-yl]ethanol |
| SMILES | Nc1ncnc(N2CCN(CCO)CC2)c1N |
| InChI | InChI=1S/C10H18N6O/c11-8-9(12)13-7-14-10(8)16-3-1-15(2-4-16)5-6-17/h7,17H,1-6,11H2,(H2,12,13,14) |
| InChIKey | SLKKMQBUGQEPSH-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |