C15H20N6O2 — CID 19140705
2-[4-(5-amino-6-pyridin-3-yloxypyrimidin-4-yl)piperazin-1-yl]ethanol (PubChem CID 19140705) has the molecular formula C15H20N6O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[4-(5-amino-6-pyridin-3-yloxypyrimidin-4-yl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(5-amino-6-pyridin-3-yloxypyrimidin-4-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 19140705 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-[4-(5-amino-6-pyridin-3-yloxypyrimidin-4-yl)piperazin-1-yl]ethanol |
| SMILES | Nc1c(Oc2cccnc2)ncnc1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C15H20N6O2/c16-13-14(21-6-4-20(5-7-21)8-9-22)18-11-19-15(13)23-12-2-1-3-17-10-12/h1-3,10-11,22H,4-9,16H2 |
| InChIKey | ACDXQMXFGQXRLR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |