C12H21N5 — CID 80757172
5-methyl-6-(4-propylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 80757172) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-methyl-6-(4-propylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | 5-methyl-6-(4-propylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80757172 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 5-methyl-6-(4-propylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CCCN1CCN(c2ncnc(N)c2C)CC1 |
| InChI | InChI=1S/C12H21N5/c1-3-4-16-5-7-17(8-6-16)12-10(2)11(13)14-9-15-12/h9H,3-8H2,1-2H3,(H2,13,14,15) |
| InChIKey | ZRSIIUSFFITGLN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |