C13H24N6 — CID 80825002
6-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-methylpyrimidin-4-amine (PubChem CID 80825002) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is 6-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-methylpyrimidin-4-amine.
| Compound Name | 6-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80825002 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 6-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(N)ncnc1N1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C13H24N6/c1-11-12(14)15-10-16-13(11)19-8-6-18(7-9-19)5-4-17(2)3/h10H,4-9H2,1-3H3,(H2,14,15,16) |
| InChIKey | UAYFXLCRNNSQQK-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |