C13H23N5 — CID 80824589
5-methyl-6-[4-(2-methylpropyl)piperazin-1-yl]pyrimidin-4-amine (PubChem CID 80824589) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 5-methyl-6-[4-(2-methylpropyl)piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | 5-methyl-6-[4-(2-methylpropyl)piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80824589 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 5-methyl-6-[4-(2-methylpropyl)piperazin-1-yl]pyrimidin-4-amine |
| SMILES | Cc1c(N)ncnc1N1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C13H23N5/c1-10(2)8-17-4-6-18(7-5-17)13-11(3)12(14)15-9-16-13/h9-10H,4-8H2,1-3H3,(H2,14,15,16) |
| InChIKey | SJMIUAOKZFGQDW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |