C11H19N5 — CID 78929729
6-(4-propylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 78929729) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 6-(4-propylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | 6-(4-propylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 78929729 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 6-(4-propylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CCCN1CCN(c2cc(N)ncn2)CC1 |
| InChI | InChI=1S/C11H19N5/c1-2-3-15-4-6-16(7-5-15)11-8-10(12)13-9-14-11/h8-9H,2-7H2,1H3,(H2,12,13,14) |
| InChIKey | LOWKSGBCZQNRFK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |