C8H8ClN3 — CID 177331332
5-chloro-7-ethyl-1H-imidazo[4,5-b]pyridine (PubChem CID 177331332) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is 5-chloro-7-ethyl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-7-ethyl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 177331332 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 5-chloro-7-ethyl-1H-imidazo[4,5-b]pyridine |
| SMILES | CCc1cc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C8H8ClN3/c1-2-5-3-6(9)12-8-7(5)10-4-11-8/h3-4H,2H2,1H3,(H,10,11,12) |
| InChIKey | DTMYAZPWAUGWRJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|