About 5,6-diethyl-1H-imidazo[4,5-b]pyridine
5,6-diethyl-1H-imidazo[4,5-b]pyridine (PubChem CID 89128817) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 5,6-diethyl-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 5,6-diethyl-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 89128817 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 5,6-diethyl-1H-imidazo[4,5-b]pyridine |
| SMILES | CCc1cc2[nH]cnc2nc1CC |
| InChI | InChI=1S/C10H13N3/c1-3-7-5-9-10(12-6-11-9)13-8(7)4-2/h5-6H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | DOLPILWWDMSMCJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-diethyl-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethyl-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 5,6-diethyl-1H-imidazo[4,5-b]pyridine (CID 89128817) is 5,6-diethyl-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 5,6-diethyl-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 5,6-diethyl-1H-imidazo[4,5-b]pyridine is CCc1cc2[nH]cnc2nc1CC.
What is the InChIKey of 5,6-diethyl-1H-imidazo[4,5-b]pyridine?
The InChIKey is DOLPILWWDMSMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-3-7-5-9-10(12-6-11-9)13-8(7)4-2/h5-6H,3-4H2,1-2H3,(H,11,12,13).
What are the key properties of 5,6-diethyl-1H-imidazo[4,5-b]pyridine?
5,6-diethyl-1H-imidazo[4,5-b]pyridine has a molecular weight of 175.23 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyl-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 89128817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).