C7H9N5 — CID 19795383
2-ethyl-7H-purin-6-amine (PubChem CID 19795383) has the molecular formula C7H9N5 and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-ethyl-7H-purin-6-amine.
| Compound Name | 2-ethyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 19795383 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 2-ethyl-7H-purin-6-amine |
| SMILES | CCc1nc(N)c2[nH]cnc2n1 |
| InChI | InChI=1S/C7H9N5/c1-2-4-11-6(8)5-7(12-4)10-3-9-5/h3H,2H2,1H3,(H3,8,9,10,11,12) |
| InChIKey | BNKDQKJMJDGFGA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |