C8H6F5N5 — CID 87990472
2-(2,2,3,3,3-pentafluoropropyl)-7H-purin-6-amine (PubChem CID 87990472) has the molecular formula C8H6F5N5 and a molecular weight of 267.16 g/mol. Its IUPAC name is 2-(2,2,3,3,3-pentafluoropropyl)-7H-purin-6-amine.
| Compound Name | 2-(2,2,3,3,3-pentafluoropropyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 87990472 |
| Molecular Formula | C8H6F5N5 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-(2,2,3,3,3-pentafluoropropyl)-7H-purin-6-amine |
| SMILES | Nc1nc(CC(F)(F)C(F)(F)F)nc2nc[nH]c12 |
| InChI | InChI=1S/C8H6F5N5/c9-7(10,8(11,12)13)1-3-17-5(14)4-6(18-3)16-2-15-4/h2H,1H2,(H3,14,15,16,17,18) |
| InChIKey | DVGRUDBSLCPSBV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|