C9H12N6O — CID 19762005
(NZ)-N-[4-(6-amino-7H-purin-2-yl)butan-2-ylidene]hydroxylamine (PubChem CID 19762005) has the molecular formula C9H12N6O and a molecular weight of 220.24 g/mol. Its IUPAC name is (NZ)-N-[4-(6-amino-7H-purin-2-yl)butan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[4-(6-amino-7H-purin-2-yl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 19762005 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (NZ)-N-[4-(6-amino-7H-purin-2-yl)butan-2-ylidene]hydroxylamine |
| SMILES | C/C(CCc1nc(N)c2[nH]cnc2n1)=N/O |
| InChI | InChI=1S/C9H12N6O/c1-5(15-16)2-3-6-13-8(10)7-9(14-6)12-4-11-7/h4,16H,2-3H2,1H3,(H3,10,11,12,13,14)/b15-5- |
| InChIKey | WXSLWKCKRGRSOI-WCSRMQSCSA-N |
| XLogP | 0.72 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|