C8H12N5O4P — CID 175895615
[2-(6-amino-7H-purin-2-yl)-1-deuterioethoxy]methylphosphonic acid (PubChem CID 175895615) has the molecular formula C8H12N5O4P and a molecular weight of 274.20 g/mol. Its IUPAC name is [2-(6-amino-7H-purin-2-yl)-1-deuterioethoxy]methylphosphonic acid.
| Compound Name | [2-(6-amino-7H-purin-2-yl)-1-deuterioethoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 175895615 |
| Molecular Formula | C8H12N5O4P |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | [2-(6-amino-7H-purin-2-yl)-1-deuterioethoxy]methylphosphonic acid |
| SMILES | [2H]C(Cc1nc(N)c2[nH]cnc2n1)OCP(=O)(O)O |
| InChI | InChI=1S/C8H12N5O4P/c9-7-6-8(11-3-10-6)13-5(12-7)1-2-17-4-18(14,15)16/h3H,1-2,4H2,(H2,14,15,16)(H3,9,10,11,12,13)/i2D |
| InChIKey | SRAQADSPYOXWIG-VMNATFBRSA-N |
| XLogP | -0.37 |
| TPSA | 147.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|