About 2-octyl-7H-purin-6-amine
2-octyl-7H-purin-6-amine (PubChem CID 139890933) has the molecular formula C13H21N5
and a molecular weight of 247.35 g/mol. Its IUPAC name is 2-octyl-7H-purin-6-amine.
Molecular Properties
| Compound Name | 2-octyl-7H-purin-6-amine |
| PubChem CID | 139890933 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 2-octyl-7H-purin-6-amine |
| SMILES | CCCCCCCCc1nc(N)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H21N5/c1-2-3-4-5-6-7-8-10-17-12(14)11-13(18-10)16-9-15-11/h9H,2-8H2,1H3,(H3,14,15,16,17,18) |
| InChIKey | ABVZDTWXFRDQDI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octyl-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octyl-7H-purin-6-amine?
The IUPAC name of 2-octyl-7H-purin-6-amine (CID 139890933) is 2-octyl-7H-purin-6-amine.
What is the SMILES notation for 2-octyl-7H-purin-6-amine?
The canonical SMILES for 2-octyl-7H-purin-6-amine is CCCCCCCCc1nc(N)c2[nH]cnc2n1.
What is the InChIKey of 2-octyl-7H-purin-6-amine?
The InChIKey is ABVZDTWXFRDQDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5/c1-2-3-4-5-6-7-8-10-17-12(14)11-13(18-10)16-9-15-11/h9H,2-8H2,1H3,(H3,14,15,16,17,18).
What are the key properties of 2-octyl-7H-purin-6-amine?
2-octyl-7H-purin-6-amine has a molecular weight of 247.35 g/mol, XLogP of 2.84, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octyl-7H-purin-6-amine is sourced from PubChem (CID 139890933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).