C15H25N7 — CID 143940334
2-[5-(4-methylpiperazin-1-yl)pentyl]-7H-purin-6-amine (PubChem CID 143940334) has the molecular formula C15H25N7 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[5-(4-methylpiperazin-1-yl)pentyl]-7H-purin-6-amine.
| Compound Name | 2-[5-(4-methylpiperazin-1-yl)pentyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 143940334 |
| Molecular Formula | C15H25N7 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 2-[5-(4-methylpiperazin-1-yl)pentyl]-7H-purin-6-amine |
| SMILES | CN1CCN(CCCCCc2nc(N)c3[nH]cnc3n2)CC1 |
| InChI | InChI=1S/C15H25N7/c1-21-7-9-22(10-8-21)6-4-2-3-5-12-19-14(16)13-15(20-12)18-11-17-13/h11H,2-10H2,1H3,(H3,16,17,18,19,20) |
| InChIKey | JIIQGNITOLHXTN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|