About chloromercury;2-methoxy-7H-purin-6-amine
chloromercury;2-methoxy-7H-purin-6-amine (PubChem CID 69287233) has the molecular formula C6H7ClHgN5O
and a molecular weight of 401.20 g/mol. Its IUPAC name is chloromercury;2-methoxy-7H-purin-6-amine.
Molecular Properties
| Compound Name | chloromercury;2-methoxy-7H-purin-6-amine |
| PubChem CID | 69287233 |
| Molecular Formula | C6H7ClHgN5O |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | chloromercury;2-methoxy-7H-purin-6-amine |
| SMILES | COc1nc(N)c2[nH]cnc2n1.Cl[Hg] |
| InChI | InChI=1S/C6H7N5O.ClH.Hg/c1-12-6-10-4(7)3-5(11-6)9-2-8-3;;/h2H,1H3,(H3,7,8,9,10,11);1H;/q;;+1/p-1 |
| InChIKey | INXJFHCDAZWCHN-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloromercury;2-methoxy-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromercury;2-methoxy-7H-purin-6-amine?
The IUPAC name of chloromercury;2-methoxy-7H-purin-6-amine (CID 69287233) is chloromercury;2-methoxy-7H-purin-6-amine.
What is the SMILES notation for chloromercury;2-methoxy-7H-purin-6-amine?
The canonical SMILES for chloromercury;2-methoxy-7H-purin-6-amine is COc1nc(N)c2[nH]cnc2n1.Cl[Hg].
What is the InChIKey of chloromercury;2-methoxy-7H-purin-6-amine?
The InChIKey is INXJFHCDAZWCHN-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7N5O.ClH.Hg/c1-12-6-10-4(7)3-5(11-6)9-2-8-3;;/h2H,1H3,(H3,7,8,9,10,11);1H;/q;;+1/p-1.
What are the key properties of chloromercury;2-methoxy-7H-purin-6-amine?
chloromercury;2-methoxy-7H-purin-6-amine has a molecular weight of 401.20 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chloromercury;2-methoxy-7H-purin-6-amine is sourced from PubChem (CID 69287233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).