C15H18N6O3 — CID 174749279
2-N-methyl-2-N-(3,4,5-trimethoxyphenyl)-7H-purine-2,6-diamine (PubChem CID 174749279) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-N-methyl-2-N-(3,4,5-trimethoxyphenyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-methyl-2-N-(3,4,5-trimethoxyphenyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 174749279 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-N-methyl-2-N-(3,4,5-trimethoxyphenyl)-7H-purine-2,6-diamine |
| SMILES | COc1cc(N(C)c2nc(N)c3[nH]cnc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C15H18N6O3/c1-21(15-19-13(16)11-14(20-15)18-7-17-11)8-5-9(22-2)12(24-4)10(6-8)23-3/h5-7H,1-4H3,(H3,16,17,18,19,20) |
| InChIKey | GZXSROARFHLSMV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |