C10H13N8+ — CID 123932271
2-N-ethyl-2-N-(1H-imidazol-3-ium-5-yl)-7H-purine-2,6-diamine (PubChem CID 123932271) has the molecular formula C10H13N8+ and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-N-ethyl-2-N-(1H-imidazol-3-ium-5-yl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-ethyl-2-N-(1H-imidazol-3-ium-5-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 123932271 |
| Molecular Formula | C10H13N8+ |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-N-ethyl-2-N-(1H-imidazol-3-ium-5-yl)-7H-purine-2,6-diamine |
| SMILES | CCN(c1nc(N)c2[nH]cnc2n1)c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C10H12N8/c1-2-18(6-3-12-4-13-6)10-16-8(11)7-9(17-10)15-5-14-7/h3-5H,2H2,1H3,(H,12,13)(H3,11,14,15,16,17)/p+1 |
| InChIKey | CAMXAEBJEALVIQ-UHFFFAOYSA-O |
| XLogP | 0.24 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |