C12H16N10O4S — CID 118855862
bis(2-methyl-7H-purin-6-amine);sulfuric acid (PubChem CID 118855862) has the molecular formula C12H16N10O4S and a molecular weight of 396.39 g/mol. Its IUPAC name is bis(2-methyl-7H-purin-6-amine);sulfuric acid.
| Compound Name | bis(2-methyl-7H-purin-6-amine);sulfuric acid |
|---|---|
| PubChem CID | 118855862 |
| Molecular Formula | C12H16N10O4S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | bis(2-methyl-7H-purin-6-amine);sulfuric acid |
| SMILES | Cc1nc(N)c2[nH]cnc2n1.Cc1nc(N)c2[nH]cnc2n1.O=S(=O)(O)O |
| InChI | InChI=1S/2C6H7N5.H2O4S/c2*1-3-10-5(7)4-6(11-3)9-2-8-4;1-5(2,3)4/h2*2H,1H3,(H3,7,8,9,10,11);(H2,1,2,3,4) |
| InChIKey | YVSFOQOZBNPPFS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 235.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|