C7H7N5O2 — CID 45089293
methyl 6-amino-7H-purine-2-carboxylate (PubChem CID 45089293) has the molecular formula C7H7N5O2 and a molecular weight of 193.17 g/mol. Its IUPAC name is methyl 6-amino-7H-purine-2-carboxylate.
| Compound Name | methyl 6-amino-7H-purine-2-carboxylate |
|---|---|
| PubChem CID | 45089293 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | methyl 6-amino-7H-purine-2-carboxylate |
| SMILES | COC(=O)c1nc(N)c2[nH]cnc2n1 |
| InChI | InChI=1S/C7H7N5O2/c1-14-7(13)6-11-4(8)3-5(12-6)10-2-9-3/h2H,1H3,(H3,8,9,10,11,12) |
| InChIKey | GCOKIACILXQMEF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |