C8H11N7O — CID 140616343
3-amino-N-(6-amino-7H-purin-2-yl)propanamide (PubChem CID 140616343) has the molecular formula C8H11N7O and a molecular weight of 221.22 g/mol. Its IUPAC name is 3-amino-N-(6-amino-7H-purin-2-yl)propanamide.
| Compound Name | 3-amino-N-(6-amino-7H-purin-2-yl)propanamide |
|---|---|
| PubChem CID | 140616343 |
| Molecular Formula | C8H11N7O |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-amino-N-(6-amino-7H-purin-2-yl)propanamide |
| SMILES | NCCC(=O)Nc1nc(N)c2[nH]cnc2n1 |
| InChI | InChI=1S/C8H11N7O/c9-2-1-4(16)13-8-14-6(10)5-7(15-8)12-3-11-5/h3H,1-2,9H2,(H4,10,11,12,13,14,15,16) |
| InChIKey | ZHKROGVSFMDNKE-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |