C11H14ClN5O — CID 114052462
N-(6-chloro-7H-purin-2-yl)-4-methylpentanamide (PubChem CID 114052462) has the molecular formula C11H14ClN5O and a molecular weight of 267.72 g/mol. Its IUPAC name is N-(6-chloro-7H-purin-2-yl)-4-methylpentanamide.
| Compound Name | N-(6-chloro-7H-purin-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 114052462 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-(6-chloro-7H-purin-2-yl)-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)Nc1nc(Cl)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H14ClN5O/c1-6(2)3-4-7(18)15-11-16-9(12)8-10(17-11)14-5-13-8/h5-6H,3-4H2,1-2H3,(H2,13,14,15,16,17,18) |
| InChIKey | BIOIXJFRMMGRHY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |