C11H10ClN5O — CID 171679860
6-chloro-N-[1-(furan-3-yl)ethyl]-7H-purin-2-amine (PubChem CID 171679860) has the molecular formula C11H10ClN5O and a molecular weight of 263.69 g/mol. Its IUPAC name is 6-chloro-N-[1-(furan-3-yl)ethyl]-7H-purin-2-amine.
| Compound Name | 6-chloro-N-[1-(furan-3-yl)ethyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 171679860 |
| Molecular Formula | C11H10ClN5O |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 6-chloro-N-[1-(furan-3-yl)ethyl]-7H-purin-2-amine |
| SMILES | CC(Nc1nc(Cl)c2[nH]cnc2n1)c1ccoc1 |
| InChI | InChI=1S/C11H10ClN5O/c1-6(7-2-3-18-4-7)15-11-16-9(12)8-10(17-11)14-5-13-8/h2-6H,1H3,(H2,13,14,15,16,17) |
| InChIKey | YYCXFAXZUNCXEQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |