C9H13N5S — CID 114788291
N-methyl-6-propan-2-ylsulfanyl-7H-purin-2-amine (PubChem CID 114788291) has the molecular formula C9H13N5S and a molecular weight of 223.30 g/mol. Its IUPAC name is N-methyl-6-propan-2-ylsulfanyl-7H-purin-2-amine.
| Compound Name | N-methyl-6-propan-2-ylsulfanyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114788291 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-methyl-6-propan-2-ylsulfanyl-7H-purin-2-amine |
| SMILES | CNc1nc(SC(C)C)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H13N5S/c1-5(2)15-8-6-7(12-4-11-6)13-9(10-3)14-8/h4-5H,1-3H3,(H2,10,11,12,13,14) |
| InChIKey | SSGSFFBCTXNLMZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |