C10H9N7S — CID 114788385
N-methyl-6-pyrazin-2-ylsulfanyl-7H-purin-2-amine (PubChem CID 114788385) has the molecular formula C10H9N7S and a molecular weight of 259.30 g/mol. Its IUPAC name is N-methyl-6-pyrazin-2-ylsulfanyl-7H-purin-2-amine.
| Compound Name | N-methyl-6-pyrazin-2-ylsulfanyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114788385 |
| Molecular Formula | C10H9N7S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-methyl-6-pyrazin-2-ylsulfanyl-7H-purin-2-amine |
| SMILES | CNc1nc(Sc2cnccn2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H9N7S/c1-11-10-16-8-7(14-5-15-8)9(17-10)18-6-4-12-2-3-13-6/h2-5H,1H3,(H2,11,14,15,16,17) |
| InChIKey | KZPPNVQHOHEDDJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |