C12H15N7S — CID 114788229
6-(1-methylimidazol-2-yl)sulfanyl-N-propyl-7H-purin-2-amine (PubChem CID 114788229) has the molecular formula C12H15N7S and a molecular weight of 289.37 g/mol. Its IUPAC name is 6-(1-methylimidazol-2-yl)sulfanyl-N-propyl-7H-purin-2-amine.
| Compound Name | 6-(1-methylimidazol-2-yl)sulfanyl-N-propyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114788229 |
| Molecular Formula | C12H15N7S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 6-(1-methylimidazol-2-yl)sulfanyl-N-propyl-7H-purin-2-amine |
| SMILES | CCCNc1nc(Sc2nccn2C)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H15N7S/c1-3-4-13-11-17-9-8(15-7-16-9)10(18-11)20-12-14-5-6-19(12)2/h5-7H,3-4H2,1-2H3,(H2,13,15,16,17,18) |
| InChIKey | KMUNATFJSLBQDS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |