C14H24N6 — CID 114783815
6-N-methyl-6-N-(2-methylbutyl)-2-N-propyl-7H-purine-2,6-diamine (PubChem CID 114783815) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is 6-N-methyl-6-N-(2-methylbutyl)-2-N-propyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-methyl-6-N-(2-methylbutyl)-2-N-propyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114783815 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 6-N-methyl-6-N-(2-methylbutyl)-2-N-propyl-7H-purine-2,6-diamine |
| SMILES | CCCNc1nc(N(C)CC(C)CC)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H24N6/c1-5-7-15-14-18-12-11(16-9-17-12)13(19-14)20(4)8-10(3)6-2/h9-10H,5-8H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | QMWBCXCDQBXABP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |