C12H17N5S — CID 114788381
6-(cyclopentylmethylsulfanyl)-N-methyl-7H-purin-2-amine (PubChem CID 114788381) has the molecular formula C12H17N5S and a molecular weight of 263.37 g/mol. Its IUPAC name is 6-(cyclopentylmethylsulfanyl)-N-methyl-7H-purin-2-amine.
| Compound Name | 6-(cyclopentylmethylsulfanyl)-N-methyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114788381 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 6-(cyclopentylmethylsulfanyl)-N-methyl-7H-purin-2-amine |
| SMILES | CNc1nc(SCC2CCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H17N5S/c1-13-12-16-10-9(14-7-15-10)11(17-12)18-6-8-4-2-3-5-8/h7-8H,2-6H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | SPAFASRZRFQVLV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |