C12H18N6S — CID 114785710
2-N-methyl-6-N-(thian-2-ylmethyl)-7H-purine-2,6-diamine (PubChem CID 114785710) has the molecular formula C12H18N6S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-N-methyl-6-N-(thian-2-ylmethyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-methyl-6-N-(thian-2-ylmethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785710 |
| Molecular Formula | C12H18N6S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-N-methyl-6-N-(thian-2-ylmethyl)-7H-purine-2,6-diamine |
| SMILES | CNc1nc(NCC2CCCCS2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H18N6S/c1-13-12-17-10(9-11(18-12)16-7-15-9)14-6-8-4-2-3-5-19-8/h7-8H,2-6H2,1H3,(H3,13,14,15,16,17,18) |
| InChIKey | HYSBCTWKNJXRGL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |