C12H18N6 — CID 114783648
6-N-cyclopentyl-2-N-ethyl-7H-purine-2,6-diamine (PubChem CID 114783648) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 6-N-cyclopentyl-2-N-ethyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-cyclopentyl-2-N-ethyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114783648 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 6-N-cyclopentyl-2-N-ethyl-7H-purine-2,6-diamine |
| SMILES | CCNc1nc(NC2CCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H18N6/c1-2-13-12-17-10-9(14-7-15-10)11(18-12)16-8-5-3-4-6-8/h7-8H,2-6H2,1H3,(H3,13,14,15,16,17,18) |
| InChIKey | MHHWTMRTHAGASJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |