C15H22N6 — CID 114785499
6-N-(2,2-dicyclopropylethyl)-2-N-ethyl-7H-purine-2,6-diamine (PubChem CID 114785499) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 6-N-(2,2-dicyclopropylethyl)-2-N-ethyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(2,2-dicyclopropylethyl)-2-N-ethyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785499 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 6-N-(2,2-dicyclopropylethyl)-2-N-ethyl-7H-purine-2,6-diamine |
| SMILES | CCNc1nc(NCC(C2CC2)C2CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C15H22N6/c1-2-16-15-20-13(12-14(21-15)19-8-18-12)17-7-11(9-3-4-9)10-5-6-10/h8-11H,2-7H2,1H3,(H3,16,17,18,19,20,21) |
| InChIKey | MVCXLXFCXJVUKB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |