C16H25N7 — CID 141001606
2-N-(4-aminocyclohexyl)-6-N-cyclopentyl-7H-purine-2,6-diamine (PubChem CID 141001606) has the molecular formula C16H25N7 and a molecular weight of 315.43 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-cyclopentyl-7H-purine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-cyclopentyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 141001606 |
| Molecular Formula | C16H25N7 |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-cyclopentyl-7H-purine-2,6-diamine |
| SMILES | NC1CCC(Nc2nc(NC3CCCC3)c3[nH]cnc3n2)CC1 |
| InChI | InChI=1S/C16H25N7/c17-10-5-7-12(8-6-10)21-16-22-14-13(18-9-19-14)15(23-16)20-11-3-1-2-4-11/h9-12H,1-8,17H2,(H3,18,19,20,21,22,23) |
| InChIKey | NAOUMMNYSRPMCR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |