C17H23Cl2N7 — CID 22149693
2-N-(4-aminocyclohexyl)-6-N-phenyl-7H-purine-2,6-diamine;dihydrochloride (PubChem CID 22149693) has the molecular formula C17H23Cl2N7 and a molecular weight of 396.33 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-phenyl-7H-purine-2,6-diamine;dihydrochloride.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-phenyl-7H-purine-2,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 22149693 |
| Molecular Formula | C17H23Cl2N7 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-phenyl-7H-purine-2,6-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(Nc2nc(Nc3ccccc3)c3[nH]cnc3n2)CC1 |
| InChI | InChI=1S/C17H21N7.2ClH/c18-11-6-8-13(9-7-11)22-17-23-15-14(19-10-20-15)16(24-17)21-12-4-2-1-3-5-12;;/h1-5,10-11,13H,6-9,18H2,(H3,19,20,21,22,23,24);2*1H |
| InChIKey | LWNUEFHMKAUCJI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |