C20H22N6S — CID 11567043
6-N-(1-benzothiophen-6-yl)-2-N-cycloheptyl-7H-purine-2,6-diamine (PubChem CID 11567043) has the molecular formula C20H22N6S and a molecular weight of 378.51 g/mol. Its IUPAC name is 6-N-(1-benzothiophen-6-yl)-2-N-cycloheptyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(1-benzothiophen-6-yl)-2-N-cycloheptyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 11567043 |
| Molecular Formula | C20H22N6S |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 6-N-(1-benzothiophen-6-yl)-2-N-cycloheptyl-7H-purine-2,6-diamine |
| SMILES | c1nc2nc(NC3CCCCCC3)nc(Nc3ccc4ccsc4c3)c2[nH]1 |
| InChI | InChI=1S/C20H22N6S/c1-2-4-6-14(5-3-1)24-20-25-18-17(21-12-22-18)19(26-20)23-15-8-7-13-9-10-27-16(13)11-15/h7-12,14H,1-6H2,(H3,21,22,23,24,25,26) |
| InChIKey | UEGSHTDRVUYVIW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |