C13H13N7 — CID 25121463
6-N-cyclopropyl-2-N-pyridin-4-yl-7H-purine-2,6-diamine (PubChem CID 25121463) has the molecular formula C13H13N7 and a molecular weight of 267.30 g/mol. Its IUPAC name is 6-N-cyclopropyl-2-N-pyridin-4-yl-7H-purine-2,6-diamine.
| Compound Name | 6-N-cyclopropyl-2-N-pyridin-4-yl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 25121463 |
| Molecular Formula | C13H13N7 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 6-N-cyclopropyl-2-N-pyridin-4-yl-7H-purine-2,6-diamine |
| SMILES | c1cc(Nc2nc(NC3CC3)c3[nH]cnc3n2)ccn1 |
| InChI | InChI=1S/C13H13N7/c1-2-8(1)17-12-10-11(16-7-15-10)19-13(20-12)18-9-3-5-14-6-4-9/h3-8H,1-2H2,(H3,14,15,16,17,18,19,20) |
| InChIKey | MMQLAGFVWKYYCH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |