C21H23N9 — CID 117086660
6-N-(1-benzylpiperidin-4-yl)-2-N-pyrazin-2-yl-7H-purine-2,6-diamine (PubChem CID 117086660) has the molecular formula C21H23N9 and a molecular weight of 401.48 g/mol. Its IUPAC name is 6-N-(1-benzylpiperidin-4-yl)-2-N-pyrazin-2-yl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(1-benzylpiperidin-4-yl)-2-N-pyrazin-2-yl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 117086660 |
| Molecular Formula | C21H23N9 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 6-N-(1-benzylpiperidin-4-yl)-2-N-pyrazin-2-yl-7H-purine-2,6-diamine |
| SMILES | c1ccc(CN2CCC(Nc3nc(Nc4cnccn4)nc4nc[nH]c34)CC2)cc1 |
| InChI | InChI=1S/C21H23N9/c1-2-4-15(5-3-1)13-30-10-6-16(7-11-30)26-20-18-19(25-14-24-18)28-21(29-20)27-17-12-22-8-9-23-17/h1-5,8-9,12,14,16H,6-7,10-11,13H2,(H3,23,24,25,26,27,28,29) |
| InChIKey | NXQDMBMIIJMHFA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |