C19H23N7O2 — CID 177165542
1-[[3-[[6-(methylamino)-7H-purin-2-yl]amino]phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 177165542) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-[[3-[[6-(methylamino)-7H-purin-2-yl]amino]phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[3-[[6-(methylamino)-7H-purin-2-yl]amino]phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 177165542 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-[[3-[[6-(methylamino)-7H-purin-2-yl]amino]phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | CNc1nc(Nc2cccc(CN3CCC(C(=O)O)CC3)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C19H23N7O2/c1-20-16-15-17(22-11-21-15)25-19(24-16)23-14-4-2-3-12(9-14)10-26-7-5-13(6-8-26)18(27)28/h2-4,9,11,13H,5-8,10H2,1H3,(H,27,28)(H3,20,21,22,23,24,25) |
| InChIKey | YZAFIFOEFOEQPX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |