C16H14N6O — CID 162666414
2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]-N-methylacetamide (PubChem CID 162666414) has the molecular formula C16H14N6O and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]-N-methylacetamide.
| Compound Name | 2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 162666414 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]-N-methylacetamide |
| SMILES | C#Cc1nc(Nc2cccc(CC(=O)NC)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C16H14N6O/c1-3-12-14-15(19-9-18-14)22-16(21-12)20-11-6-4-5-10(7-11)8-13(23)17-2/h1,4-7,9H,8H2,2H3,(H,17,23)(H2,18,19,20,21,22) |
| InChIKey | OWMQEJLNUZKFOM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|