C18H23N7O — CID 69241404
3-[[6-[[(2R)-3,3-dimethylbutan-2-yl]amino]-7H-purin-2-yl]amino]benzamide (PubChem CID 69241404) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is 3-[[6-[[(2R)-3,3-dimethylbutan-2-yl]amino]-7H-purin-2-yl]amino]benzamide.
| Compound Name | 3-[[6-[[(2R)-3,3-dimethylbutan-2-yl]amino]-7H-purin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 69241404 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 3-[[6-[[(2R)-3,3-dimethylbutan-2-yl]amino]-7H-purin-2-yl]amino]benzamide |
| SMILES | C[C@@H](Nc1nc(Nc2cccc(C(N)=O)c2)nc2nc[nH]c12)C(C)(C)C |
| InChI | InChI=1S/C18H23N7O/c1-10(18(2,3)4)22-16-13-15(21-9-20-13)24-17(25-16)23-12-7-5-6-11(8-12)14(19)26/h5-10H,1-4H3,(H2,19,26)(H3,20,21,22,23,24,25)/t10-/m1/s1 |
| InChIKey | PGQOKXVKBRKCMK-SNVBAGLBSA-N |
| XLogP | 3.04 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |