C17H17N7O — CID 25120412
2-[[2-(quinolin-6-ylamino)-7H-purin-6-yl]amino]propan-1-ol (PubChem CID 25120412) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is 2-[[2-(quinolin-6-ylamino)-7H-purin-6-yl]amino]propan-1-ol.
| Compound Name | 2-[[2-(quinolin-6-ylamino)-7H-purin-6-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 25120412 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-[[2-(quinolin-6-ylamino)-7H-purin-6-yl]amino]propan-1-ol |
| SMILES | CC(CO)Nc1nc(Nc2ccc3ncccc3c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C17H17N7O/c1-10(8-25)21-16-14-15(20-9-19-14)23-17(24-16)22-12-4-5-13-11(7-12)3-2-6-18-13/h2-7,9-10,25H,8H2,1H3,(H3,19,20,21,22,23,24) |
| InChIKey | YBSRXCKXOCDXOE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |